![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| CHANGELOG.md | 2026-02-10 19:34 | 9.0K | |
| CONTRIBUTING.md | 2026-02-10 19:34 | 2.4K | |
| README.md | 2026-02-10 19:34 | 1.9K | |
| background-image.pdf | 2026-02-10 19:34 | 30K | |
| background-image.tex | 2026-02-10 19:34 | 337 | |
| float-centering.pdf | 2026-02-10 19:34 | 19K | |
| float-centering.tex | 2026-02-10 19:34 | 263 | |
| footer-text.pdf | 2026-02-10 19:34 | 26K | |
| footer-text.tex | 2026-02-10 19:34 | 558 | |
| header-footer-color.pdf | 2026-02-10 19:34 | 20K | |
| header-footer-color.tex | 2026-02-10 19:34 | 303 | |
| index.md | 2026-02-10 19:34 | 1.5K | |
| lists-actions.pdf | 2026-02-10 19:34 | 20K | |
| lists-actions.tex | 2026-02-10 19:34 | 212 | |
| lists-overlays.pdf | 2026-02-10 19:34 | 20K | |
| lists-overlays.tex | 2026-02-10 19:34 | 207 | |
| ltx-talk-code.pdf | 2026-02-10 19:34 | 460K | |
| ltx-talk-code.tex | 2026-02-10 19:34 | 2.4K | |
| ltx-talk-color.dtx | 2026-02-10 19:34 | 5.9K | |
| ltx-talk-decode.dtx | 2026-02-10 19:34 | 15K | |
| ltx-talk-frame-structure.dtx | 2026-02-10 19:34 | 11K | |
| ltx-talk-frame.dtx | 2026-02-10 19:34 | 24K | |
| ltx-talk-mode.dtx | 2026-02-10 19:34 | 2.4K | |
| ltx-talk-overlay.dtx | 2026-02-10 19:34 | 21K | |
| ltx-talk-required.dtx | 2026-02-10 19:34 | 4.4K | |
| ltx-talk-structure.dtx | 2026-02-10 19:34 | 22K | |
| ltx-talk-title.dtx | 2026-02-10 19:34 | 8.8K | |
| ltx-talk.dtx | 2026-02-10 19:34 | 12K | |
| ltx-talk.ins | 2026-02-10 19:34 | 2.7K | |
| ltx-talk.pdf | 2026-02-10 19:34 | 327K | |
| ltx-talk.tex | 2026-02-10 19:34 | 71K | |
| math-fonts.pdf | 2026-02-10 19:34 | 52K | |
| math-fonts.tex | 2026-02-10 19:34 | 1.6K | |
| overlays-opacity.pdf | 2026-02-10 19:34 | 20K | |
| overlays-opacity.tex | 2026-02-10 19:34 | 251 | |
| titlepage-styling.pdf | 2026-02-10 19:34 | 25K | |
| titlepage-styling.tex | 2026-02-10 19:34 | 558 | |
| totalframes.pdf | 2026-02-10 19:34 | 20K | |
| totalframes.tex | 2026-02-10 19:34 | 256 | |
| verbatim-alt-env.pdf | 2026-02-10 19:34 | 23K | |
| verbatim-alt-env.tex | 2026-02-10 19:34 | 319 | |
| verbatim-content.pdf | 2026-02-10 19:34 | 22K | |
| verbatim-content.tex | 2026-02-10 19:34 | 319 | |