![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| animals.bib | 2024-01-30 13:57 | 1.6K | |
| bacteria.bib | 2024-01-30 13:57 | 1.2K | |
| baseunits.bib | 2024-01-30 13:57 | 1.0K | |
| bigmathsymbols.bib | 2024-01-30 13:57 | 2.9K | |
| binaryoperators.bib | 2024-01-30 13:57 | 576 | |
| books.bib | 2024-01-30 13:57 | 3.4K | |
| chemicalformula.bib | 2024-01-30 13:57 | 2.5K | |
| citations.bib | 2024-01-30 13:57 | 1.3K | |
| constants.bib | 2024-01-30 13:57 | 2.3K | |
| derivedunits.bib | 2024-01-30 13:57 | 1.5K | |
| films.bib | 2024-01-30 13:57 | 5.3K | |
| interpret-preamble.bib | 2024-01-30 13:57 | 328 | |
| interpret-preamble2.bib | 2024-01-30 13:57 | 338 | |
| markuplanguages.bib | 2024-01-30 13:57 | 1.7K | |
| mathgreek.bib | 2024-01-30 13:57 | 3.1K | |
| mathsobjects.bib | 2024-01-30 13:57 | 3.6K | |
| mathsrelations.bib | 2024-01-30 13:57 | 1.2K | |
| minerals.bib | 2024-01-30 13:57 | 2.4K | |
| miscsymbols.bib | 2024-01-30 13:57 | 2.2K | |
| no-interpret-preamble.bib | 2024-01-30 13:57 | 328 | |
| people.bib | 2024-01-30 13:57 | 4.3K | |
| sample-authors.pdf | 2024-01-30 13:57 | 50K | |
| sample-authors.tex | 2024-01-30 13:57 | 1.5K | |
| sample-bacteria.pdf | 2024-01-30 13:57 | 53K | |
| sample-bacteria.tex | 2024-01-30 13:57 | 1.3K | |
| sample-chemical.pdf | 2024-01-30 13:57 | 53K | |
| sample-chemical.tex | 2024-01-30 13:57 | 1.3K | |
| sample-citations.pdf | 2024-01-30 13:57 | 49K | |
| sample-citations.tex | 2024-01-30 13:57 | 1.9K | |
| sample-constants.pdf | 2024-01-30 13:57 | 96K | |
| sample-constants.tex | 2024-01-30 13:57 | 1.3K | |
| sample-hierarchical.pdf | 2024-01-30 13:57 | 51K | |
| sample-hierarchical.tex | 2024-01-30 13:57 | 1.0K | |
| sample-markuplanguages.pdf | 2024-01-30 13:57 | 60K | |
| sample-markuplanguages.tex | 2024-01-30 13:57 | 1.4K | |
| sample-maths.pdf | 2024-01-30 13:57 | 118K | |
| sample-maths.tex | 2024-01-30 13:57 | 3.1K | |
| sample-media.pdf | 2024-01-30 13:57 | 163K | |
| sample-media.tex | 2024-01-30 13:57 | 1.7K | |
| sample-msymbols.pdf | 2024-01-30 13:57 | 107K | |
| sample-msymbols.tex | 2024-01-30 13:57 | 780 | |
| sample-multi1.pdf | 2024-01-30 13:57 | 249K | |
| sample-multi1.tex | 2024-01-30 13:57 | 5.4K | |
| sample-multi2.pdf | 2024-01-30 13:57 | 323K | |
| sample-multi2.tex | 2024-01-30 13:57 | 12K | |
| sample-nested.pdf | 2024-01-30 13:57 | 51K | |
| sample-nested.tex | 2024-01-30 13:57 | 1.3K | |
| sample-people.pdf | 2024-01-30 13:57 | 49K | |
| sample-people.tex | 2024-01-30 13:57 | 2.3K | |
| sample-textsymbols.pdf | 2024-01-30 13:57 | 71K | |
| sample-textsymbols.tex | 2024-01-30 13:57 | 1.2K | |
| sample-textsymbols2.pdf | 2024-01-30 13:57 | 69K | |
| sample-textsymbols2.tex | 2024-01-30 13:57 | 913 | |
| sample-units1.pdf | 2024-01-30 13:57 | 56K | |
| sample-units1.tex | 2024-01-30 13:57 | 1.0K | |
| sample-units2.pdf | 2024-01-30 13:57 | 58K | |
| sample-units2.tex | 2024-01-30 13:57 | 1.2K | |
| sample-units3.pdf | 2024-01-30 13:57 | 44K | |
| sample-units3.tex | 2024-01-30 13:57 | 1.7K | |
| sample-usergroups.pdf | 2024-01-30 13:57 | 24K | |
| sample-usergroups.tex | 2024-01-30 13:57 | 3.2K | |
| terms.bib | 2024-01-30 13:57 | 640 | |
| topics.bib | 2024-01-30 13:57 | 266 | |
| unaryoperators.bib | 2024-01-30 13:57 | 557 | |
| usergroups.bib | 2024-01-30 13:57 | 4.0K | |
| vegetables.bib | 2024-01-30 13:57 | 1.1K | |